Products 5905-02-2
CAS 5905-02-2 is the registry number for Dimethyl 2,2'-bifuran-5,5'-dicarboxylate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
Methyl 5-(5-methoxycarbonylfuran-2-yl)furan-2-carboxylate (CAS 5905-02-2) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: methyl 5-(5-methoxycarbonylfuran-2-yl)furan-2-carboxylate. InChIKey: JWIYSMDVJXYZFS-UHFFFAOYSA-N.
| Molecular formula | C12H10O6 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | methyl 5-(5-methoxycarbonylfuran-2-yl)furan-2-carboxylate |
| InChIKey | JWIYSMDVJXYZFS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(O1)C2=CC=C(O2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2,2'-bifuran-5,5'-dicarboxylate, 2,2'-Bifuran-5,5'-dicarboxylic acid dimethyl ester, Dimethyl [2,2'-bifuran]-5,5'-dicarboxylate, [2,2'-Bifuran]-5,5'-dicarboxylic acid, dimethyl ester, methyl 5-(5-methoxycarbonylfuran-2-yl)furan-2-carboxylate, JWIYSMDVJXYZFS-UHFFFAOYSA-N, Dimethyl 2,2''-bifuran-5,5''-dicarboxylate, [2,2'-Bifuran]-5,5'-dicarboxylic acid, 5,5'-dimethyl ester