Products 4945-72-6
CAS 4945-72-6 appears in our catalog under these names: Tetrahydro-1,5:6,10-dimethanooxepino[4,5-d]oxepine-2,4,7,9(1H,5H)-tetraone, 95%, Tetrahydro-1,5:6,10-dimethanooxepino[4,5-d]oxepine-2,4,7,9(1H,5H)-tetraone, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone (CAS 4945-72-6) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone. InChIKey: ILOCNLYUKFZVBP-UHFFFAOYSA-N.
| Molecular formula | C12H10O6 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone |
| InChIKey | ILOCNLYUKFZVBP-UHFFFAOYSA-N |
| SMILES | C1C2C3C4CC(C3C1C(=O)OC2=O)C(=O)OC4=O |
Computed by PubChem (NCBI)