Products 438197-19-4
CAS 438197-19-4 appears in our catalog under these names: 2，3–Dichlorobenzohydrazide, 2,3-Dichlorobenzohydrazide 95%, 2,3-Dichlorobenzohydrazide, 96%, 96%, 2,3-Dichlorobenzhydrazide, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100mg, 500mg.
2,3-dichlorobenzohydrazide (CAS 438197-19-4) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,3-dichlorobenzohydrazide. InChIKey: BXJDUQVJADYYCG-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,3-dichlorobenzohydrazide |
| InChIKey | BXJDUQVJADYYCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)NN |
Computed by PubChem (NCBI)