Products 4382-34-7
CAS 4382-34-7 is the registry number for Robtin. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, Get quote.
(2S)-7-hydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one (CAS 4382-34-7) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: (2S)-7-hydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: RZPNYDYGMFMXLQ-ZDUSSCGKSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | (2S)-7-hydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | RZPNYDYGMFMXLQ-ZDUSSCGKSA-N |
| SMILES | C1[C@H](OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C(=C3)O)O)O |
Computed by PubChem (NCBI)