CAS 438473-78-0 is the registry number for 3-(2-Bromophenoxymethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[(2-bromophenoxy)methyl]benzoic acid (CAS 438473-78-0) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-[(2-bromophenoxy)methyl]benzoic acid. InChIKey: OGTOSXWRKAZOKL-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 3-[(2-bromophenoxy)methyl]benzoic acid |
| InChIKey | OGTOSXWRKAZOKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC(=CC=C2)C(=O)O)Br |
Computed by PubChem (NCBI)