CAS 439088-74-1 appears in our catalog under these names: Elobixibat Impurity 1, tert-Butyl (R)-(2-amino-2-phenylacetyl)glycinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[[(2R)-2-amino-2-phenylacetyl]amino]acetate (CAS 439088-74-1) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl 2-[[(2R)-2-amino-2-phenylacetyl]amino]acetate. InChIKey: ZCERGRXTTGLHFZ-GFCCVEGCSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | tert-butyl 2-[[(2R)-2-amino-2-phenylacetyl]amino]acetate |
| InChIKey | ZCERGRXTTGLHFZ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)