CAS 439113-83-4 appears in our catalog under these names: 1-(2-Oxo-4-phenyloxazolidin-3-yl)-5-phenylpentane-1,5-dione, 95%, Ezetimibe Impurity 70. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-5-phenylpentane-1,5-dione (CAS 439113-83-4) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-5-phenylpentane-1,5-dione. InChIKey: QDEPBLVOADHQSK-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-5-phenylpentane-1,5-dione |
| InChIKey | QDEPBLVOADHQSK-UHFFFAOYSA-N |
| SMILES | C1C(N(C(=O)O1)C(=O)CCCC(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)