CAS 439147-95-2 appears in our catalog under these names: 4-Chloro-2,5,8-trimethylquinoline, 95%, 95%, 4-Chloro-2,5,8-trimethylquinoline, 97%. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, on request.
4-chloro-2,5,8-trimethylquinoline (CAS 439147-95-2) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 4-chloro-2,5,8-trimethylquinoline. InChIKey: OKNZZVAEBHNPDW-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 4-chloro-2,5,8-trimethylquinoline |
| InChIKey | OKNZZVAEBHNPDW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=NC2=C(C=C1)C)C)Cl |
Computed by PubChem (NCBI)