Products 439900-84-2
CAS 439900-84-2 is the registry number for Gnetifolin M. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1 mg.
2-(3-hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol (CAS 439900-84-2) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-(3-hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol. InChIKey: LNYJPSJEXBTRPO-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-(3-hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol |
| InChIKey | LNYJPSJEXBTRPO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)O)C2=CC3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)