Products 441801-03-2

CAS 441801-03-2 is the registry number for 6-Chloro-3-methyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-chloro-3-methyl-1H-indole-2-carboxylic acid (CAS 441801-03-2) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 6-chloro-3-methyl-1H-indole-2-carboxylic acid. InChIKey: DYVDDDKAEPQDGB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO2
Molecular weight209.63 g/mol
IUPAC name6-chloro-3-methyl-1H-indole-2-carboxylic acid
InChIKeyDYVDDDKAEPQDGB-UHFFFAOYSA-N
SMILESCC1=C(NC2=C1C=CC(=C2)Cl)C(=O)O

Computed by PubChem (NCBI)