CAS 443124-54-7 is the registry number for 5-(1H-1,3-Benzodiazol-2-yl)-2-methoxyaniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(1H-benzimidazol-2-yl)-2-methoxyaniline (CAS 443124-54-7) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 5-(1H-benzimidazol-2-yl)-2-methoxyaniline. InChIKey: LOAAJBOHHXFWPZ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 5-(1H-benzimidazol-2-yl)-2-methoxyaniline |
| InChIKey | LOAAJBOHHXFWPZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3N2)N |
Computed by PubChem (NCBI)