Products 447416-70-8
CAS 447416-70-8 appears in our catalog under these names: (S)-3-Amino-3-(3,4-difluorophenyl)propanoic acid, 98%, 98%, (3S)-3-AMINO-3-(3,4-DIFLUOROPHENYL)PROPANOIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(3S)-3-amino-3-(3,4-difluorophenyl)propanoic acid (CAS 447416-70-8) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (3S)-3-amino-3-(3,4-difluorophenyl)propanoic acid. InChIKey: BBQXXTOCYJPXDI-QMMMGPOBSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,4-difluorophenyl)propanoic acid |
| InChIKey | BBQXXTOCYJPXDI-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CC(=O)O)N)F)F |
Computed by PubChem (NCBI)