CAS 449199-19-3 appears in our catalog under these names: 2,7,8-Trimethyl-4-quinolinol, 95%, 2,7,8-Trimethylquinolin-4-ol, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2,7,8-trimethyl-1H-quinolin-4-one (CAS 449199-19-3) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,7,8-trimethyl-1H-quinolin-4-one. InChIKey: UXTKZNADIFVKBK-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,7,8-trimethyl-1H-quinolin-4-one |
| InChIKey | UXTKZNADIFVKBK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C=C(N2)C)C |
Computed by PubChem (NCBI)