CAS 775302-21-1 is the registry number for (3-[5-(4-Methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 775302-21-1) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: XHHUZHPBTZQUSD-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | XHHUZHPBTZQUSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)