Products 452076-93-6
CAS 452076-93-6 is the registry number for 6-Fluoro-2H-chromene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-fluoro-2H-chromene-3-carboxylic acid (CAS 452076-93-6) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: 6-fluoro-2H-chromene-3-carboxylic acid. InChIKey: RYQBMPMHJYOSON-UHFFFAOYSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 6-fluoro-2H-chromene-3-carboxylic acid |
| InChIKey | RYQBMPMHJYOSON-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)