CAS 458526-08-4 is the registry number for 6-(Benzyloxy)indolin-2-one, 96%. Offered by: AmBeed. Available pack sizes: 1g.
6-phenylmethoxy-1,3-dihydroindol-2-one (CAS 458526-08-4) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 6-phenylmethoxy-1,3-dihydroindol-2-one. InChIKey: MZWXDZCHYCAVBA-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 6-phenylmethoxy-1,3-dihydroindol-2-one |
| InChIKey | MZWXDZCHYCAVBA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)OCC3=CC=CC=C3)NC1=O |
Computed by PubChem (NCBI)