CAS 4591-55-3 appears in our catalog under these names: Dimethyl 3,5-Pyridinedicarboxylate, >98.0%(GC)(T), Dimethyl pyridine-3,5-dicarboxylate 98%, Dimethyl pyridine-3,5-dicarboxylate, 98%, 98%, Pyridine-3,5-dicarboxylic acid dimethyl ester, 97%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100g, 500g, 1kg.
Dimethyl pyridine-3,5-dicarboxylate (CAS 4591-55-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-3,5-dicarboxylate. InChIKey: HDTNLHHNQYBOHJ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-3,5-dicarboxylate |
| InChIKey | HDTNLHHNQYBOHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN=C1)C(=O)OC |
Computed by PubChem (NCBI)