Products 459423-19-9
CAS 459423-19-9 is the registry number for (3,3-Dimethyl-2,3-dihydrobenzofuran-5-yl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(3,3-dimethyl-2H-1-benzofuran-5-yl)boronic acid (CAS 459423-19-9) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (3,3-dimethyl-2H-1-benzofuran-5-yl)boronic acid. InChIKey: WHLSLQGNOXHUSW-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (3,3-dimethyl-2H-1-benzofuran-5-yl)boronic acid |
| InChIKey | WHLSLQGNOXHUSW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCC2(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3,3-Dimethyl-2,3-dihydrobenzofuran-5-yl)boronic acid, [3,3-Dimethyl-2,3-dihydrobenzofuran-5-yl]boronic acid, WHLSLQGNOXHUSW-UHFFFAOYSA-N, 3,3-dimethyl-2,3-dihydro-benzofuran-5-boronic acid, (3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl)boronic acid, Boronic acid, B-(2,3-dihydro-3,3-dimethyl-5-benzofuranyl)-