Products 19460-85-6
CAS 19460-85-6 appears in our catalog under these names: Bzl-Ala-OMe hydrochloride, 97%, Bzl–L–Ala–OMe Hydrochloride, Bzl-L-Ala-OMe*HCl, Bzl-Ala-OMe·HCl 98%, BZL-ALA-OME HCL, 96%, 96%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g.
Methyl (2S)-2-(benzylamino)propanoate;hydrochloride (CAS 19460-85-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)propanoate;hydrochloride. InChIKey: FJUWPAKLUHULRE-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)propanoate;hydrochloride |
| InChIKey | FJUWPAKLUHULRE-FVGYRXGTSA-N |
| SMILES | C[C@@H](C(=O)OC)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-methyl 2-(benzylamino)propanoate hydrochloride, BZL-ALA-OME HCL, methyl (2S)-2-(benzylamino)propanoate;hydrochloride, Bzl-ala-ome hydrochloride, N-benzylalanine methyl ester hydrochloride, n-benzyl-l-alanine methyl ester hydrochloride, Methyl N-benzyl-L-alaninate--hydrogen chloride (1/1), N-alpha-Benzyl-L-alanine methyl ester hydrochloride, Bzl-L-Ala-OMe Hydrochloride, N-alpha-Benzyl-L-alanine methy