Products 95071-12-8
CAS 95071-12-8 appears in our catalog under these names: Bzl-d-ala-ome hydrochloride, 95%, Bzl-D-Ala-OMe*HCl, Bzl-d-ala-ome hcl, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 25g, 10g.
Methyl (2R)-2-(benzylamino)propanoate;hydrochloride (CAS 95071-12-8) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (2R)-2-(benzylamino)propanoate;hydrochloride. InChIKey: FJUWPAKLUHULRE-SBSPUUFOSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (2R)-2-(benzylamino)propanoate;hydrochloride |
| InChIKey | FJUWPAKLUHULRE-SBSPUUFOSA-N |
| SMILES | C[C@H](C(=O)OC)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
BZL-D-ALA-OME HCL, (R)-Methyl 2-(benzylamino)propanoate hydrochloride, D-Alanine, N-(phenylmethyl)-, methyl ester, hydrochloride, methyl (2R)-2-(benzylamino)propanoate;hydrochloride, N-Benzyl-D-alanine methyl ester HCl, Bzl-D-Ala-OMe Hydrochloride, N-Benzyl-D-alanine methyl ester hydrochloride, Methyl (R)-2-(Benzylamino)propanoate Hydrochloride