CAS 4613-53-0 appears in our catalog under these names: 6-Aminoflavone, 95%, 6-AMINOFLAVONE, 97%, 6-Aminoflavone, 6-Aminoflavone, 98%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g.
6-amino-2-phenylchromen-4-one (CAS 4613-53-0) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 6-amino-2-phenylchromen-4-one. InChIKey: YWHKBWPNCFDUPQ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 6-amino-2-phenylchromen-4-one |
| InChIKey | YWHKBWPNCFDUPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)