CAS 46276-24-8 is the registry number for 5-Cyanotryptamine. Offered by: TRC. Available pack sizes: 2,5g.
3-(2-aminoethyl)-1H-indole-5-carbonitrile (CAS 46276-24-8) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indole-5-carbonitrile. InChIKey: NYEZIGVQPDFDQF-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indole-5-carbonitrile |
| InChIKey | NYEZIGVQPDFDQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)CCN |
Computed by PubChem (NCBI)