Products 46427-07-0
CAS 46427-07-0 appears in our catalog under these names: (E)-2-Benzylidenesuccinic acid, 97%, 97%, Butanedioic acid,(phenylmethylene)-,(E)-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g.
(2E)-2-benzylidenebutanedioic acid (CAS 46427-07-0) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: (2E)-2-benzylidenebutanedioic acid. InChIKey: KYILORDWJFEQBS-RMKNXTFCSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (2E)-2-benzylidenebutanedioic acid |
| InChIKey | KYILORDWJFEQBS-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(\CC(=O)O)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-2-benzylidenebutanedioic acid, (E)-2-benzylidenesuccinic acid, 2-benzylidenesuccinic acid, Succinic acid, benzylidene-, (2E)-2-(phenylmethylidene)butanedioic acid, Butanedioic acid,(phenylmethylene)-,(E)-, (E)-phenylitaconic acid, starbld0019338, 2-(e)-benzylidenesuccin, 2-Propene-1, 3-phenyl-