CAS 5653-88-3 appears in our catalog under these names: (E)-2-benzylidenesuccinic acid, 95%, 2-Benzylidenesuccinic Acid (Mixture of E/Z-Isomers), 2-(Phenylmethylene)Butanedioic Acid, 97%, 97%, 2-benzylidenesuccinic acid, 97%. Offered by: Combi-blocks, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, on request, 100mg, 25g, 100g.
2-benzylidenebutanedioic acid (CAS 5653-88-3) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 2-benzylidenebutanedioic acid. InChIKey: KYILORDWJFEQBS-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2-benzylidenebutanedioic acid |
| InChIKey | KYILORDWJFEQBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)