CAS 464916-25-4 appears in our catalog under these names: 1-(2-Ethoxy-2-oxoethyl)-3-methyl-1H-imidazol-3-ium chloride, 98%, Ethyl 2–(3–methyl–2,3–dihydro–1H–imidazol–1–yl)acetate hydrochloride, 1-(2-Ethoxy-2-oxoethyl)-3-methyl-1H-imidazolium chloride, 98%+(HPLC),RG, 98%+(HPLC),RG, Ethyl 2-(3-methyl-2,3-dihydro-1H-imidazol-1-yl)acetate hydrochloride, 98%+(HPLC),RG. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g, 500g.
Ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate chloride (CAS 464916-25-4) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate chloride. InChIKey: PCBZAYBLMIPEQT-UHFFFAOYSA-M.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate chloride |
| InChIKey | PCBZAYBLMIPEQT-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CN1C=C[N+](=C1)C.[Cl-] |
Computed by PubChem (NCBI)