Products 4675-18-7
CAS 4675-18-7 appears in our catalog under these names: 4,5-DIPHENYLOXAZOLE, 97%, 4,5-Diphenyloxazole, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4,5-diphenyl-1,3-oxazole (CAS 4675-18-7) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 4,5-diphenyl-1,3-oxazole. InChIKey: ODKHOKLXMBWVOQ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4,5-diphenyl-1,3-oxazole |
| InChIKey | ODKHOKLXMBWVOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)