CAS 4702-36-7 is the registry number for 8-Hydroxy-1H-isochromen-1-one. Offered by: TRC. Available pack sizes: 250mg.
8-hydroxyisochromen-1-one (CAS 4702-36-7) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 8-hydroxyisochromen-1-one. InChIKey: GZFXAOPNTDYZLP-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 8-hydroxyisochromen-1-one |
| InChIKey | GZFXAOPNTDYZLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)OC=C2 |
Computed by PubChem (NCBI)