CAS 4720-99-4 is the registry number for 4,4'–(Ethene–1,2–diyl)dibenzaldehyde. Offered by: GLPBio. Available pack sizes: 1g.
4-[2-(4-formylphenyl)ethenyl]benzaldehyde (CAS 4720-99-4) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 4-[2-(4-formylphenyl)ethenyl]benzaldehyde. InChIKey: NCAJMNHLAZAVRZ-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-[2-(4-formylphenyl)ethenyl]benzaldehyde |
| InChIKey | NCAJMNHLAZAVRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)C=O)C=O |
Computed by PubChem (NCBI)