CAS 474397-16-5 is the registry number for 4-(4-Methylpyrimidin-2-yl)aniline. Offered by: TRC, Biosynth. Available pack sizes: 1g, 100mg.
4-(4-methylpyrimidin-2-yl)aniline (CAS 474397-16-5) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 4-(4-methylpyrimidin-2-yl)aniline. InChIKey: BTZGFOODEXURGK-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-(4-methylpyrimidin-2-yl)aniline |
| InChIKey | BTZGFOODEXURGK-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)