CAS 475105-77-2 appears in our catalog under these names: 2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzoic acid, 95%, 2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzoic acid, 2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzoic acid, 97% . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 1g, 250mg, 0,5g, 5g.
2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid (CAS 475105-77-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid. InChIKey: JHLHKCWPDVKWNS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| InChIKey | JHLHKCWPDVKWNS-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)