CAS 4763-58-0 appears in our catalog under these names: 2-Acetyl-nicotinic acid ethyl ester, 95%, 2-acetyl-nicotinic acid ethyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Ethyl 2-acetylpyridine-3-carboxylate (CAS 4763-58-0) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: ethyl 2-acetylpyridine-3-carboxylate. InChIKey: RIQXKNANXXJUHS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | ethyl 2-acetylpyridine-3-carboxylate |
| InChIKey | RIQXKNANXXJUHS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC=C1)C(=O)C |
Computed by PubChem (NCBI)