CAS 477199-77-2 appears in our catalog under these names: 4–(Bromomethyl)–2–fluorobenzoic Acid, 4-(Bromomethyl)-2-fluorobenzoic acid, 95%, 4-(Bromomethyl)-2-fluorobenzoic acid, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-(bromomethyl)-2-fluorobenzoic acid (CAS 477199-77-2) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-(bromomethyl)-2-fluorobenzoic acid. InChIKey: WSTLFAWLFXOZKC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluorobenzoic acid |
| InChIKey | WSTLFAWLFXOZKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)F)C(=O)O |
Computed by PubChem (NCBI)