CAS 480438-94-6 appears in our catalog under these names: N-(2-Oxo-4-(trifluoromethyl)-2H-chromen-7-yl)acrylamide, 98%, 7-(4-TRIFLUOROMETHYL)COUMARIN ACRYLAMID&. Offered by: AmBeed, Sigma-Aldrich. Available pack sizes: 10g, 100MG.
N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]prop-2-enamide (CAS 480438-94-6) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]prop-2-enamide. InChIKey: WJZFVBAYCVHWRE-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]prop-2-enamide |
| InChIKey | WJZFVBAYCVHWRE-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)