CAS 480439-44-9 is the registry number for 2-Bromo-4-Fluorophenyl Acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-bromo-4-fluorophenyl) acetate (CAS 480439-44-9) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: (2-bromo-4-fluorophenyl) acetate. InChIKey: CJIWSSICZXCQSS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | (2-bromo-4-fluorophenyl) acetate |
| InChIKey | CJIWSSICZXCQSS-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)