Products 480439-44-9

CAS 480439-44-9 is the registry number for 2-Bromo-4-Fluorophenyl Acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2-bromo-4-fluorophenyl) acetate (CAS 480439-44-9) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: (2-bromo-4-fluorophenyl) acetate. InChIKey: CJIWSSICZXCQSS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrFO2
Molecular weight233.03 g/mol
IUPAC name(2-bromo-4-fluorophenyl) acetate
InChIKeyCJIWSSICZXCQSS-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C=C(C=C1)F)Br

Computed by PubChem (NCBI)