Products 482308-11-2
CAS 482308-11-2 is the registry number for 5-Amino-2-(3-oxo-4-morpholinyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
5-amino-2-(3-oxomorpholin-4-yl)benzonitrile (CAS 482308-11-2) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 5-amino-2-(3-oxomorpholin-4-yl)benzonitrile. InChIKey: UWVQVSGACKTALD-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-amino-2-(3-oxomorpholin-4-yl)benzonitrile |
| InChIKey | UWVQVSGACKTALD-UHFFFAOYSA-N |
| SMILES | C1COCC(=O)N1C2=C(C=C(C=C2)N)C#N |
Computed by PubChem (NCBI)