CAS 482579-01-1 is the registry number for N-Acetyldopamine dimers B, 99.38%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
N-[2-[(2S,3R)-3-acetamido-2-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethyl]acetamide (CAS 482579-01-1) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: N-[2-[(2S,3R)-3-acetamido-2-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethyl]acetamide. InChIKey: VUANWDRZYTXGPI-VQTJNVASSA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | N-[2-[(2S,3R)-3-acetamido-2-(3,4-dihydroxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethyl]acetamide |
| InChIKey | VUANWDRZYTXGPI-VQTJNVASSA-N |
| SMILES | CC(=O)NCCC1=CC2=C(C=C1)O[C@H]([C@@H](O2)NC(=O)C)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)