CAS 4826-22-6 appears in our catalog under these names: 3-(1,1-Dioxido-2H-benzo(e)(1,2,4)thiadiazin-3-yl)propanoic acid, 98%, 3-(1,1-Dioxido-4H-benzo[e][1,2,4]thiadiazin-3-yl)propanoic acid, 98%, 98%, 3-(1,1-Dioxido-4H-benzo[e][1,2,4]thiadiazin-3-yl)propanoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid (CAS 4826-22-6) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid. InChIKey: ZSZXWCIFIBRNAW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4S |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid |
| InChIKey | ZSZXWCIFIBRNAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=NS2(=O)=O)CCC(=O)O |
Computed by PubChem (NCBI)