CAS 4854-84-6 appears in our catalog under these names: 4–Amino–4'–cyanobiphenyl, 4-Cyano-4'-aminobiphenyl, 4-Amino-4'-cyanobiphenyl, >95.0%(GC), 4-Amino-[1,1-biphenyl]-4-carbonitrile 98%, 4'-Amino-biphenyl-4-carbonitrile, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
4-(4-aminophenyl)benzonitrile (CAS 4854-84-6) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 4-(4-aminophenyl)benzonitrile. InChIKey: CPJQKNUJNWPAPH-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-(4-aminophenyl)benzonitrile |
| InChIKey | CPJQKNUJNWPAPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)