CAS 490034-62-3 appears in our catalog under these names: (3S)-3-Amino-3-(2-methylphenyl)propanoic acid hydrochloride, (3S)-3-Amino-3-(2-methylphenyl)propanoic acid hydrochloride, 95%, (S)-3-Amino-3-(o-tolyl)propanoic acid hydrochloride, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 1g, 5g, 25g.
(3S)-3-amino-3-(2-methylphenyl)propanoic acid;hydrochloride (CAS 490034-62-3) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3S)-3-amino-3-(2-methylphenyl)propanoic acid;hydrochloride. InChIKey: WYZNGUGIWQZIPN-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-methylphenyl)propanoic acid;hydrochloride |
| InChIKey | WYZNGUGIWQZIPN-FVGYRXGTSA-N |
| SMILES | CC1=CC=CC=C1[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)