Products 491601-47-9
CAS 491601-47-9 is the registry number for (5,6-Dimethoxy-2-phenyl-1H-indol-3-yl)-acetic acid methyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
Methyl 2-(5,6-dimethoxy-2-phenyl-1H-indol-3-yl)acetate (CAS 491601-47-9) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: methyl 2-(5,6-dimethoxy-2-phenyl-1H-indol-3-yl)acetate. InChIKey: ZOXGOVILLQFUFN-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | methyl 2-(5,6-dimethoxy-2-phenyl-1H-indol-3-yl)acetate |
| InChIKey | ZOXGOVILLQFUFN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(N2)C3=CC=CC=C3)CC(=O)OC)OC |
Computed by PubChem (NCBI)