CAS 4928-44-3 appears in our catalog under these names: N2-Phenylpyridine-2,5-diamine, 95%, N2-Phenylpyridine-2,5-diamine, 95+%, N2-Phenylpyridine-2,5-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 25g, 2,5g.
2-N-phenylpyridine-2,5-diamine (CAS 4928-44-3) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-N-phenylpyridine-2,5-diamine. InChIKey: NDNQUJQOJSNZGA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-N-phenylpyridine-2,5-diamine |
| InChIKey | NDNQUJQOJSNZGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(C=C2)N |
Computed by PubChem (NCBI)