Products 496-41-3
CAS 496-41-3 appears in our catalog under these names: Benzofuran-2-carboxylic acid, Benzo(b)furan-2-carboxylic acid/ 98%, 2-Benzofurancarboxylic acid, Benzo[b]furan-2-carboxylic acid, 98%, Benzofuran-2-carboxylic Acid, >99.0%(GC)(T). Offered by: TargetMol, Chemat, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 50mg, 100mg, 500mg, 25g, 50g, 1g, 5g, 100g.
1-benzofuran-2-carboxylic acid (CAS 496-41-3) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-2-carboxylic acid. InChIKey: OFFSPAZVIVZPHU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-2-carboxylic acid |
| InChIKey | OFFSPAZVIVZPHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)