CAS 49656-04-4 is the registry number for 2-Chloro-4,5-diphenyloxazole. Offered by: TRC. Available pack sizes: 100mg.
2-chloro-4,5-diphenyl-1,3-oxazole (CAS 49656-04-4) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: 2-chloro-4,5-diphenyl-1,3-oxazole. InChIKey: PAVIHTWMLRILFC-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-chloro-4,5-diphenyl-1,3-oxazole |
| InChIKey | PAVIHTWMLRILFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)