Products 49660-60-8
CAS 49660-60-8 appears in our catalog under these names: 6，8–Dichlorochroman–4–one, 6,8-Dichlorochroman-4-one, 97%, 97%, 6,8-DICHLORO-2,3-DIHYDRO-4H-CHROMEN-4-ONE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
6,8-dichloro-3,4-dihydrochromen-2-one (CAS 49660-60-8) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydrochromen-2-one. InChIKey: DNRWXABMOCRPIA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydrochromen-2-one |
| InChIKey | DNRWXABMOCRPIA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)