CAS 49711-14-0 appears in our catalog under these names: (E)-3-(Naphthalen-2-yl)acrylic acid, 95-<97%, 2-Naphthylacrylic acid, (E)-3-(Naphthalen-2-yl)acrylic acid 95%, (E)-3-(Naphthalen-2-yl)acrylic acid, 98%, 98%, (E)-3-(Naphthalen-2-yl)acrylic acid, 98%. Offered by: Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g, 50mg, 0,5g.
(E)-3-naphthalen-2-ylprop-2-enoic acid (CAS 49711-14-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: (E)-3-naphthalen-2-ylprop-2-enoic acid. InChIKey: KWGPBDBAAXYWOJ-SOFGYWHQSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (E)-3-naphthalen-2-ylprop-2-enoic acid |
| InChIKey | KWGPBDBAAXYWOJ-SOFGYWHQSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)