CAS 49711-55-9 is the registry number for 3-(Benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylic acid. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg.
(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid (CAS 49711-55-9) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid. InChIKey: LJKHUTHWDPAAIA-FPYGCLRLSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid |
| InChIKey | LJKHUTHWDPAAIA-FPYGCLRLSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)