Products 49711-55-9

CAS 49711-55-9 is the registry number for 3-(Benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylic acid. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid (CAS 49711-55-9) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid. InChIKey: LJKHUTHWDPAAIA-FPYGCLRLSA-N.

Identity
Molecular formulaC11H7NO4
Molecular weight217.18 g/mol
IUPAC name(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid
InChIKeyLJKHUTHWDPAAIA-FPYGCLRLSA-N
SMILESC1OC2=C(O1)C=C(C=C2)/C=C(\C#N)/C(=O)O

Computed by PubChem (NCBI)