CAS 500533-94-8 is the registry number for M119. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)cyclohexane-1-carboxylic acid (CAS 500533-94-8) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: 2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)cyclohexane-1-carboxylic acid. InChIKey: CAVIJGGXNIURPI-UHFFFAOYSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)cyclohexane-1-carboxylic acid |
| InChIKey | CAVIJGGXNIURPI-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C2=C3C=CC(=O)C(=C3OC4=C2C=CC(=C4O)O)O)C(=O)O |
Computed by PubChem (NCBI)