CAS 500866-01-3 appears in our catalog under these names: 2-(3-Carbamoylphenoxy)acetic acid, 2-(3-Carbamoylphenoxy)acetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-(3-carbamoylphenoxy)acetic acid (CAS 500866-01-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(3-carbamoylphenoxy)acetic acid. InChIKey: DCZLMOYGKHSTTQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(3-carbamoylphenoxy)acetic acid |
| InChIKey | DCZLMOYGKHSTTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)