Products 503468-03-9
CAS 503468-03-9 is the registry number for NU-7163. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-methylmorpholin-4-yl)benzo[h]chromen-4-one (CAS 503468-03-9) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 2-(2-methylmorpholin-4-yl)benzo[h]chromen-4-one. InChIKey: RFWCIJWQGHFULK-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 2-(2-methylmorpholin-4-yl)benzo[h]chromen-4-one |
| InChIKey | RFWCIJWQGHFULK-UHFFFAOYSA-N |
| SMILES | CC1CN(CCO1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)