CAS 503596-48-3 is the registry number for 5-(4-Isopropylphenyl)oxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-propan-2-ylphenyl)-1,3-oxazole (CAS 503596-48-3) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 5-(4-propan-2-ylphenyl)-1,3-oxazole. InChIKey: QJSUIRFOPUGAJN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 5-(4-propan-2-ylphenyl)-1,3-oxazole |
| InChIKey | QJSUIRFOPUGAJN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CN=CO2 |
Computed by PubChem (NCBI)